C32H28O6 — CID 10864115
2,2,14,14-tetramethyl-7,9,19,21-tetraoxapentacyclo[20.2.2.23,6.210,13.215,18]dotriaconta-1(24),3(32),4,6(31),10(30),11,13(29),15,17,22,25,27-dodecaene-8,20-dione (PubChem CID 10864115) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is 2,2,14,14-tetramethyl-7,9,19,21-tetraoxapentacyclo[20.2.2.23,6.210,13.215,18]dotriaconta-1(24),3(32),4,6(31),10(30),11,13(29),15,17,22,25,27-dodecaene-8,20-dione.
| Compound Name | 2,2,14,14-tetramethyl-7,9,19,21-tetraoxapentacyclo[20.2.2.23,6.210,13.215,18]dotriaconta-1(24),3(32),4,6(31),10(30),11,13(29),15,17,22,25,27-dodecaene-8,20-dione |
|---|---|
| PubChem CID | 10864115 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2,2,14,14-tetramethyl-7,9,19,21-tetraoxapentacyclo[20.2.2.23,6.210,13.215,18]dotriaconta-1(24),3(32),4,6(31),10(30),11,13(29),15,17,22,25,27-dodecaene-8,20-dione |
| SMILES | CC1(C)c2ccc(cc2)OC(=O)Oc2ccc(cc2)C(C)(C)c2ccc(cc2)OC(=O)Oc2ccc1cc2 |
| InChI | InChI=1S/C32H28O6/c1-31(2)21-5-13-25(14-6-21)35-29(33)37-27-17-9-23(10-18-27)32(3,4)24-11-19-28(20-12-24)38-30(34)36-26-15-7-22(31)8-16-26/h5-20H,1-4H3 |
| InChIKey | NTDNLQFWYYSYAY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|