C21H19Cl2NO4 — CID 108641526
(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-chlorophenyl)-1-propylpyrrolidine-2,3-dione (PubChem CID 108641526) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-chlorophenyl)-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-chlorophenyl)-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108641526 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-chlorophenyl)-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(/O)c2cc(Cl)ccc2OC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2NO4/c1-3-10-24-18(12-4-6-13(22)7-5-12)17(20(26)21(24)27)19(25)15-11-14(23)8-9-16(15)28-2/h4-9,11,18,25H,3,10H2,1-2H3/b19-17+ |
| InChIKey | KXEXZWTYCWFERD-HTXNQAPBSA-N |
| XLogP | 4.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|