C27H15F7O3 — CID 10864258
(4-phenylmethoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenyl]methanone (PubChem CID 10864258) has the molecular formula C27H15F7O3 and a molecular weight of 520.40 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenyl]methanone.
| Compound Name | (4-phenylmethoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 10864258 |
| Molecular Formula | C27H15F7O3 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (4-phenylmethoxyphenyl)-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2ccccc2)cc1)c1ccc(Oc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H15F7O3/c28-21-20(27(32,33)34)22(29)24(31)26(23(21)30)37-19-12-8-17(9-13-19)25(35)16-6-10-18(11-7-16)36-14-15-4-2-1-3-5-15/h1-13H,14H2 |
| InChIKey | RHULWCUKBVCKCD-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|