C19H22FNO4 — CID 108642681
2-(4-fluorophenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108642681) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-fluorophenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108642681 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(4-fluorophenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CC(C)C(=O)C1=C(O)C(=O)N(CC2CCCO2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO4/c1-11(2)17(22)15-16(12-5-7-13(20)8-6-12)21(19(24)18(15)23)10-14-4-3-9-25-14/h5-8,11,14,16,23H,3-4,9-10H2,1-2H3 |
| InChIKey | FZGNULNDWHLWRX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |