C24H22Cl2FNO6 — CID 108642702
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108642702) has the molecular formula C24H22Cl2FNO6 and a molecular weight of 510.35 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108642702 |
| Molecular Formula | C24H22Cl2FNO6 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(CC3CCCO3)C2c2ccc(F)cc2)c(OC)c1Cl |
| InChI | InChI=1S/C24H22Cl2FNO6/c1-32-22-15(10-16(25)23(33-2)18(22)26)20(29)17-19(12-5-7-13(27)8-6-12)28(24(31)21(17)30)11-14-4-3-9-34-14/h5-8,10,14,19,29H,3-4,9,11H2,1-2H3/b20-17+ |
| InChIKey | AVVBIZABOGUXHD-LVZFUZTISA-N |
| XLogP | 4.75 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|