C25H22FNO4 — CID 108643046
3-(1-benzofuran-2-carbonyl)-1-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 108643046) has the molecular formula C25H22FNO4 and a molecular weight of 419.45 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108643046 |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-cyclohexyl-2-(4-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(C2CCCCC2)C1c1ccc(F)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C25H22FNO4/c26-17-12-10-15(11-13-17)22-21(23(28)20-14-16-6-4-5-9-19(16)31-20)24(29)25(30)27(22)18-7-2-1-3-8-18/h4-6,9-14,18,22,29H,1-3,7-8H2 |
| InChIKey | CIXVDWSLKYYSAV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |