C26H34Cl3NO2Si — CID 10864345
N-[(E,2S)-1-[tert-butyl(diphenyl)silyl]oxyoct-3-en-2-yl]-2,2,2-trichloroacetamide (PubChem CID 10864345) has the molecular formula C26H34Cl3NO2Si and a molecular weight of 527.01 g/mol. Its IUPAC name is N-[(E,2S)-1-[tert-butyl(diphenyl)silyl]oxyoct-3-en-2-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(E,2S)-1-[tert-butyl(diphenyl)silyl]oxyoct-3-en-2-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 10864345 |
| Molecular Formula | C26H34Cl3NO2Si |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[(E,2S)-1-[tert-butyl(diphenyl)silyl]oxyoct-3-en-2-yl]-2,2,2-trichloroacetamide |
| SMILES | CCCC/C=C/[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H34Cl3NO2Si/c1-5-6-7-10-15-21(30-24(31)26(27,28)29)20-32-33(25(2,3)4,22-16-11-8-12-17-22)23-18-13-9-14-19-23/h8-19,21H,5-7,20H2,1-4H3,(H,30,31)/b15-10+/t21-/m0/s1 |
| InChIKey | MSYKNHTWMCZJNM-VPFXQZGESA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|