C32H38N2O5 — CID 10864385
6,7-dimethoxy-2-[1-[3-(4-phenylmethoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one (PubChem CID 10864385) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[1-[3-(4-phenylmethoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-2-[1-[3-(4-phenylmethoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 10864385 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 6,7-dimethoxy-2-[1-[3-(4-phenylmethoxyphenoxy)propyl]piperidin-3-yl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(C1CCCN(CCCOc3ccc(OCc4ccccc4)cc3)C1)CC2 |
| InChI | InChI=1S/C32H38N2O5/c1-36-30-20-25-15-18-34(32(35)29(25)21-31(30)37-2)26-10-6-16-33(22-26)17-7-19-38-27-11-13-28(14-12-27)39-23-24-8-4-3-5-9-24/h3-5,8-9,11-14,20-21,26H,6-7,10,15-19,22-23H2,1-2H3 |
| InChIKey | ROZKUPMORBJMBK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|