C27H33NO3 — CID 108644037
(4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-1-pentyl-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 108644037) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-1-pentyl-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-1-pentyl-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108644037 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (4Z)-4-[(3,4-dimethylphenyl)-hydroxymethylidene]-1-pentyl-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCN1C(=O)C(=O)/C(=C(\O)c2ccc(C)c(C)c2)C1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H33NO3/c1-6-7-8-15-28-24(21-13-11-20(12-14-21)17(2)3)23(26(30)27(28)31)25(29)22-10-9-18(4)19(5)16-22/h9-14,16-17,24,29H,6-8,15H2,1-5H3/b25-23- |
| InChIKey | IFQBCUWPWHJLHP-BZZOAKBMSA-N |
| XLogP | 6.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|