About (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate
(1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate (PubChem CID 10864415) has the molecular formula C27H25NO5
and a molecular weight of 443.50 g/mol. Its IUPAC name is (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate.
Molecular Properties
| Compound Name | (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate |
| PubChem CID | 10864415 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate |
| SMILES | O=C(Oc1ccc2c(c1OC(=O)c1ccccc1)CCCC21CNCCO1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO5/c29-25(19-8-3-1-4-9-19)32-23-14-13-22-21(12-7-15-27(22)18-28-16-17-31-27)24(23)33-26(30)20-10-5-2-6-11-20/h1-6,8-11,13-14,28H,7,12,15-18H2 |
| InChIKey | RWMMKIWUXKAYLV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate?
The IUPAC name of (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate (CID 10864415) is (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate.
What is the SMILES notation for (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate?
The canonical SMILES for (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate is O=C(Oc1ccc2c(c1OC(=O)c1ccccc1)CCCC21CNCCO1)c1ccccc1.
What is the InChIKey of (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate?
The InChIKey is RWMMKIWUXKAYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO5/c29-25(19-8-3-1-4-9-19)32-23-14-13-22-21(12-7-15-27(22)18-28-16-17-31-27)24(23)33-26(30)20-10-5-2-6-11-20/h1-6,8-11,13-14,28H,7,12,15-18H2.
What are the key properties of (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate?
(1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate has a molecular weight of 443.50 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzoyloxyspiro[7,8-dihydro-6H-naphthalene-5,2'-morpholine]-2-yl) benzoate is sourced from PubChem (CID 10864415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).