C27H44N4O7 — CID 10864452
(3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-oxoheptanoic acid (PubChem CID 10864452) has the molecular formula C27H44N4O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-oxoheptanoic acid.
| Compound Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-oxoheptanoic acid |
|---|---|
| PubChem CID | 10864452 |
| Molecular Formula | C27H44N4O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-oxoheptanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CC2CCCCC2N1C(=O)[C@@H](CC1CCCCC1)NCC(=O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C27H44N4O7/c28-13-7-6-11-19(24(34)27(37)38)30-25(35)22-15-18-10-4-5-12-21(18)31(22)26(36)20(29-16-23(32)33)14-17-8-2-1-3-9-17/h17-22,29H,1-16,28H2,(H,30,35)(H,32,33)(H,37,38)/t18?,19-,20+,21?,22-/m0/s1 |
| InChIKey | YSBBODNHDOIMAM-HHEBOYGLSA-N |
| XLogP | 1.43 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|