C24H16Cl2FNO4 — CID 108644887
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-phenylpyrrolidine-2,3-dione (PubChem CID 108644887) has the molecular formula C24H16Cl2FNO4 and a molecular weight of 472.30 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108644887 |
| Molecular Formula | C24H16Cl2FNO4 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-phenylpyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(c2ccccc2)C1c1ccccc1F |
| InChI | InChI=1S/C24H16Cl2FNO4/c1-32-23-16(11-13(25)12-17(23)26)21(29)19-20(15-9-5-6-10-18(15)27)28(24(31)22(19)30)14-7-3-2-4-8-14/h2-12,20,29H,1H3/b21-19+ |
| InChIKey | MESODIXFODYTNE-XUTLUUPISA-N |
| XLogP | 5.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|