C23H21ClFNO5 — CID 108645120
(4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108645120) has the molecular formula C23H21ClFNO5 and a molecular weight of 445.87 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108645120 |
| Molecular Formula | C23H21ClFNO5 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (4E)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(CC2CCCO2)C1c1ccccc1F |
| InChI | InChI=1S/C23H21ClFNO5/c1-30-18-9-8-13(24)11-16(18)21(27)19-20(15-6-2-3-7-17(15)25)26(23(29)22(19)28)12-14-5-4-10-31-14/h2-3,6-9,11,14,20,27H,4-5,10,12H2,1H3/b21-19+ |
| InChIKey | RJINJORUBCTVJA-XUTLUUPISA-N |
| XLogP | 4.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|