C24H25ClFNO4 — CID 108645958
(4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-pentylpyrrolidine-2,3-dione (PubChem CID 108645958) has the molecular formula C24H25ClFNO4 and a molecular weight of 445.92 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-pentylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-pentylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108645958 |
| Molecular Formula | C24H25ClFNO4 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-pentylpyrrolidine-2,3-dione |
| SMILES | CCCCCN1C(=O)C(=O)/C(=C(/O)c2cc(OCC)ccc2Cl)C1c1ccccc1F |
| InChI | InChI=1S/C24H25ClFNO4/c1-3-5-8-13-27-21(16-9-6-7-10-19(16)26)20(23(29)24(27)30)22(28)17-14-15(31-4-2)11-12-18(17)25/h6-7,9-12,14,21,28H,3-5,8,13H2,1-2H3/b22-20+ |
| InChIKey | XZKURWXCMAQJBQ-LSDHQDQOSA-N |
| XLogP | 5.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|