C29H39NO6SSi — CID 10864628
[(1S,3E,6S,7E)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1-phenyldeca-3,7-dienyl] carbamate (PubChem CID 10864628) has the molecular formula C29H39NO6SSi and a molecular weight of 557.79 g/mol. Its IUPAC name is [(1S,3E,6S,7E)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1-phenyldeca-3,7-dienyl] carbamate.
| Compound Name | [(1S,3E,6S,7E)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1-phenyldeca-3,7-dienyl] carbamate |
|---|---|
| PubChem CID | 10864628 |
| Molecular Formula | C29H39NO6SSi |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | [(1S,3E,6S,7E)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1-phenyldeca-3,7-dienyl] carbamate |
| SMILES | CC(=O)/C=C/[C@H](C/C(=C\C[C@H](OC(N)=O)c1ccccc1)S(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H39NO6SSi/c1-22(31)17-18-24(36-38(5,6)29(2,3)4)21-26(37(33,34)25-15-11-8-12-16-25)19-20-27(35-28(30)32)23-13-9-7-10-14-23/h7-19,24,27H,20-21H2,1-6H3,(H2,30,32)/b18-17+,26-19+/t24-,27+/m1/s1 |
| InChIKey | CAQKZNVDYHBNOZ-LMBRQICASA-N |
| XLogP | 6.50 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|