C30H48O6SSi — CID 10864687
methyl (4E)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-pent-4-enylundeca-4,10-dienoate (PubChem CID 10864687) has the molecular formula C30H48O6SSi and a molecular weight of 564.86 g/mol. Its IUPAC name is methyl (4E)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-pent-4-enylundeca-4,10-dienoate.
| Compound Name | methyl (4E)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-pent-4-enylundeca-4,10-dienoate |
|---|---|
| PubChem CID | 10864687 |
| Molecular Formula | C30H48O6SSi |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | methyl (4E)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2-pent-4-enylundeca-4,10-dienoate |
| SMILES | C=CCCCC(O)/C=C(/CO[Si](C)(C)C(C)(C)C)CC(CCCC=C)(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H48O6SSi/c1-9-11-14-18-26(31)22-25(24-36-38(7,8)29(3,4)5)23-30(28(32)35-6,21-17-12-10-2)37(33,34)27-19-15-13-16-20-27/h9-10,13,15-16,19-20,22,26,31H,1-2,11-12,14,17-18,21,23-24H2,3-8H3/b25-22+ |
| InChIKey | NCERLIOEQIZGKM-YYDJUVGSSA-N |
| XLogP | 6.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|