C24H21NO6S — CID 108646878
(4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108646878) has the molecular formula C24H21NO6S and a molecular weight of 451.50 g/mol. Its IUPAC name is (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108646878 |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(OC)c1/C(O)=C1\C(=O)C(=O)N(Cc2cccs2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C24H21NO6S/c1-30-17-9-4-10-18(31-2)19(17)22(27)20-21(14-6-3-7-15(26)12-14)25(24(29)23(20)28)13-16-8-5-11-32-16/h3-12,21,26-27H,13H2,1-2H3/b22-20+ |
| InChIKey | FPMATJGLPJJLPN-LSDHQDQOSA-N |
| XLogP | 4.09 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|