C24H18FNO5 — CID 108647112
(4E)-1-(3-fluorophenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108647112) has the molecular formula C24H18FNO5 and a molecular weight of 419.41 g/mol. Its IUPAC name is (4E)-1-(3-fluorophenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-fluorophenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108647112 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (4E)-1-(3-fluorophenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(/C(O)=C2\C(=O)C(=O)N(c3cccc(F)c3)C2c2cccc(O)c2)c1 |
| InChI | InChI=1S/C24H18FNO5/c1-31-19-10-3-6-15(12-19)22(28)20-21(14-5-2-9-18(27)11-14)26(24(30)23(20)29)17-8-4-7-16(25)13-17/h2-13,21,27-28H,1H3/b22-20+ |
| InChIKey | ODBLHNMLKWTKCD-LSDHQDQOSA-N |
| XLogP | 4.17 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|