C24H18FNO6 — CID 108647410
(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108647410) has the molecular formula C24H18FNO6 and a molecular weight of 435.41 g/mol. Its IUPAC name is (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108647410 |
| Molecular Formula | C24H18FNO6 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(F)cc1/C(O)=C1\C(=O)C(=O)N(c2ccccc2O)C1c1cccc(O)c1 |
| InChI | InChI=1S/C24H18FNO6/c1-32-19-10-9-14(25)12-16(19)22(29)20-21(13-5-4-6-15(27)11-13)26(24(31)23(20)30)17-7-2-3-8-18(17)28/h2-12,21,27-29H,1H3/b22-20+ |
| InChIKey | BPGSZRDKUOJEGT-LSDHQDQOSA-N |
| XLogP | 3.87 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|