C29H44O12 — CID 10864827
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1R)-4-[(3S)-3-acetyloxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10864827) has the molecular formula C29H44O12 and a molecular weight of 584.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1R)-4-[(3S)-3-acetyloxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1R)-4-[(3S)-3-acetyloxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10864827 |
| Molecular Formula | C29H44O12 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1R)-4-[(3S)-3-acetyloxybutyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2CC(C)=C(CC[C@H](C)OC(C)=O)C(C)(C)C2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H44O12/c1-15-12-22(13-29(8,9)23(15)11-10-16(2)36-18(4)31)40-28-27(39-21(7)34)26(38-20(6)33)25(37-19(5)32)24(41-28)14-35-17(3)30/h16,22,24-28H,10-14H2,1-9H3/t16-,22+,24+,25+,26-,27+,28+/m0/s1 |
| InChIKey | OVIFXVZHTRQSPS-JAKPOOIISA-N |
| XLogP | 3.32 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|