C23H26N2O6 — CID 108648344
(4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108648344) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108648344 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(CCN(C)C)C2c2cccc(O)c2)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O6/c1-24(2)10-11-25-20(14-6-5-7-15(26)12-14)19(22(28)23(25)29)21(27)17-9-8-16(30-3)13-18(17)31-4/h5-9,12-13,20,26-27H,10-11H2,1-4H3/b21-19- |
| InChIKey | YKKZAMQKFOZXSN-VZCXRCSSSA-N |
| XLogP | 2.39 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|