C24H23ClN2O5 — CID 108650104
(4E)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108650104) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108650104 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (4E)-4-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(/O)c2ccc(OC)c(Cl)c2)C1c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C24H23ClN2O5/c1-26-13-16(15-6-4-5-7-18(15)26)21-20(23(29)24(30)27(21)10-11-31-2)22(28)14-8-9-19(32-3)17(25)12-14/h4-9,12-13,21,28H,10-11H2,1-3H3/b22-20+ |
| InChIKey | SWXWLHGNXYJCGS-LSDHQDQOSA-N |
| XLogP | 3.91 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|