C32H48O10S — CID 10865083
[(2R,3S,4S,5R,6S)-6-(benzenesulfinyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10865083) has the molecular formula C32H48O10S and a molecular weight of 624.79 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(benzenesulfinyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(benzenesulfinyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10865083 |
| Molecular Formula | C32H48O10S |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(benzenesulfinyl)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](S(=O)c2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H48O10S/c1-29(2,3)25(33)38-18-20-21(40-26(34)30(4,5)6)22(41-27(35)31(7,8)9)23(42-28(36)32(10,11)12)24(39-20)43(37)19-16-14-13-15-17-19/h13-17,20-24H,18H2,1-12H3/t20-,21+,22+,23-,24+,43?/m1/s1 |
| InChIKey | VBHQHJWENQBJRF-MZULQBAQSA-N |
| XLogP | 4.98 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|