C37H44O5SSi — CID 10865104
(2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,4-diol (PubChem CID 10865104) has the molecular formula C37H44O5SSi and a molecular weight of 628.91 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 10865104 |
| Molecular Formula | C37H44O5SSi |
| Molecular Weight | 628.91 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | (2R,3R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C37H44O5SSi/c1-36(2,3)44(4,5)42-34-33(39)32(38)31(41-35(34)43-30-24-16-9-17-25-30)26-40-37(27-18-10-6-11-19-27,28-20-12-7-13-21-28)29-22-14-8-15-23-29/h6-25,31-35,38-39H,26H2,1-5H3/t31-,32+,33+,34-,35+/m1/s1 |
| InChIKey | BDJWBPNDSBSFDB-NVCPMKERSA-N |
| XLogP | 7.62 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.91 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|