C29H20N2O3 — CID 108651156
4-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108651156) has the molecular formula C29H20N2O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108651156 |
| Molecular Formula | C29H20N2O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1ccccc1C1/C(=C(\O)c2cccc3ccccc23)C(=O)C(=O)N1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H20N2O3/c1-18-7-2-4-10-22(18)26-25(27(32)24-12-6-9-20-8-3-5-11-23(20)24)28(33)29(34)31(26)21-15-13-19(17-30)14-16-21/h2-16,26,32H,1H3/b27-25+ |
| InChIKey | YCYWPBZKBGRMQF-IMVLJIQESA-N |
| XLogP | 5.65 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|