C33H26F8P2 — CID 10865143
[(1S,2R,3R,4R)-3-[bis(3,5-difluorophenyl)phosphanylmethyl]-2-bicyclo[2.2.1]heptanyl]methyl-bis(3,5-difluorophenyl)phosphane (PubChem CID 10865143) has the molecular formula C33H26F8P2 and a molecular weight of 636.50 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-3-[bis(3,5-difluorophenyl)phosphanylmethyl]-2-bicyclo[2.2.1]heptanyl]methyl-bis(3,5-difluorophenyl)phosphane.
| Compound Name | [(1S,2R,3R,4R)-3-[bis(3,5-difluorophenyl)phosphanylmethyl]-2-bicyclo[2.2.1]heptanyl]methyl-bis(3,5-difluorophenyl)phosphane |
|---|---|
| PubChem CID | 10865143 |
| Molecular Formula | C33H26F8P2 |
| Molecular Weight | 636.50 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | [(1S,2R,3R,4R)-3-[bis(3,5-difluorophenyl)phosphanylmethyl]-2-bicyclo[2.2.1]heptanyl]methyl-bis(3,5-difluorophenyl)phosphane |
| SMILES | Fc1cc(F)cc(P(C[C@@H]2[C@@H]3CC[C@@H](C3)[C@H]2CP(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C33H26F8P2/c34-20-4-21(35)9-28(8-20)42(29-10-22(36)5-23(37)11-29)16-32-18-1-2-19(3-18)33(32)17-43(30-12-24(38)6-25(39)13-30)31-14-26(40)7-27(41)15-31/h4-15,18-19,32-33H,1-3,16-17H2/t18-,19+,32-,33-/m1/s1 |
| InChIKey | TUEZQWLMIBEYHH-MKCKKAKPSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.50 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|