C32H52O9SSi — CID 10865165
[(2R)-1-[(4S,5S)-2,2-dimethyl-5-[3-[2-(4-methylphenyl)sulfonylethoxy]-3-oxopropyl]-1,3-dioxolan-4-yl]propan-2-yl] (E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate (PubChem CID 10865165) has the molecular formula C32H52O9SSi and a molecular weight of 640.91 g/mol. Its IUPAC name is [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[3-[2-(4-methylphenyl)sulfonylethoxy]-3-oxopropyl]-1,3-dioxolan-4-yl]propan-2-yl] (E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate.
| Compound Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[3-[2-(4-methylphenyl)sulfonylethoxy]-3-oxopropyl]-1,3-dioxolan-4-yl]propan-2-yl] (E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 10865165 |
| Molecular Formula | C32H52O9SSi |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | [(2R)-1-[(4S,5S)-2,2-dimethyl-5-[3-[2-(4-methylphenyl)sulfonylethoxy]-3-oxopropyl]-1,3-dioxolan-4-yl]propan-2-yl] (E,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)CC[C@@H]2OC(C)(C)O[C@H]2C[C@@H](C)OC(=O)/C=C/C[C@@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H52O9SSi/c1-23-14-16-26(17-15-23)42(35,36)21-20-37-29(33)19-18-27-28(40-32(7,8)39-27)22-25(3)38-30(34)13-11-12-24(2)41-43(9,10)31(4,5)6/h11,13-17,24-25,27-28H,12,18-22H2,1-10H3/b13-11+/t24-,25-,27+,28+/m1/s1 |
| InChIKey | WBQGQVOHYURHGD-VDOZSZLGSA-N |
| XLogP | 6.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|