C24H18F2N2O5 — CID 108653499
(4Z)-1-(3,4-difluorophenyl)-5-(furan-2-yl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108653499) has the molecular formula C24H18F2N2O5 and a molecular weight of 452.41 g/mol. Its IUPAC name is (4Z)-1-(3,4-difluorophenyl)-5-(furan-2-yl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3,4-difluorophenyl)-5-(furan-2-yl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108653499 |
| Molecular Formula | C24H18F2N2O5 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (4Z)-1-(3,4-difluorophenyl)-5-(furan-2-yl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CN1CCOc2ccc(/C(O)=C3/C(=O)C(=O)N(c4ccc(F)c(F)c4)C3c3ccco3)cc21 |
| InChI | InChI=1S/C24H18F2N2O5/c1-27-8-10-33-18-7-4-13(11-17(18)27)22(29)20-21(19-3-2-9-32-19)28(24(31)23(20)30)14-5-6-15(25)16(26)12-14/h2-7,9,11-12,21,29H,8,10H2,1H3/b22-20- |
| InChIKey | MTQNDSGCOALHHT-XDOYNYLZSA-N |
| XLogP | 4.01 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|