C25H21Cl2NO6 — CID 108653885
(4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108653885) has the molecular formula C25H21Cl2NO6 and a molecular weight of 502.35 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108653885 |
| Molecular Formula | C25H21Cl2NO6 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | (4Z)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3OC)C2c2ccco2)cc1 |
| InChI | InChI=1S/C25H21Cl2NO6/c1-4-13-7-9-14(10-8-13)28-20(17-6-5-11-34-17)18(22(30)25(28)31)21(29)15-12-16(26)24(33-3)19(27)23(15)32-2/h5-12,20,29H,4H2,1-3H3/b21-18- |
| InChIKey | JYULSGQDELSIEY-UZYVYHOESA-N |
| XLogP | 5.79 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|