C18H17NO5 — CID 108653949
2-(furan-2-yl)-4-hydroxy-1-(2-hydroxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108653949) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-hydroxy-1-(2-hydroxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(furan-2-yl)-4-hydroxy-1-(2-hydroxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108653949 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(furan-2-yl)-4-hydroxy-1-(2-hydroxyphenyl)-3-(2-methylpropanoyl)-2H-pyrrol-5-one |
| SMILES | CC(C)C(=O)C1=C(O)C(=O)N(c2ccccc2O)C1c1ccco1 |
| InChI | InChI=1S/C18H17NO5/c1-10(2)16(21)14-15(13-8-5-9-24-13)19(18(23)17(14)22)11-6-3-4-7-12(11)20/h3-10,15,20,22H,1-2H3 |
| InChIKey | BSZGJCVKDDDBMI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |