C20H21NO5 — CID 108654214
2-(furan-2-yl)-4-hydroxy-1-(4-methoxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one (PubChem CID 108654214) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-hydroxy-1-(4-methoxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(furan-2-yl)-4-hydroxy-1-(4-methoxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108654214 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-(furan-2-yl)-4-hydroxy-1-(4-methoxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
| SMILES | COc1ccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2ccco2)cc1 |
| InChI | InChI=1S/C20H21NO5/c1-12(2)11-15(22)17-18(16-5-4-10-26-16)21(20(24)19(17)23)13-6-8-14(25-3)9-7-13/h4-10,12,18,23H,11H2,1-3H3 |
| InChIKey | QEMPORAJYXKEHE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |