C38H70O5Sn — CID 10865467
(2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(E,1S)-1-hydroxy-3-tributylstannylprop-2-enyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol (PubChem CID 10865467) has the molecular formula C38H70O5Sn and a molecular weight of 725.68 g/mol. Its IUPAC name is (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(E,1S)-1-hydroxy-3-tributylstannylprop-2-enyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol.
| Compound Name | (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(E,1S)-1-hydroxy-3-tributylstannylprop-2-enyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 10865467 |
| Molecular Formula | C38H70O5Sn |
| Molecular Weight | 725.68 g/mol |
| Exact Mass | 726.42 |
| IUPAC Name | (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(E,1S)-1-hydroxy-3-tributylstannylprop-2-enyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol |
| SMILES | CCCC[C@]1([C@@H](O)/C=C/[Sn](CCCC)(CCCC)CCCC)CC[C@]2(CC[C@H](C)[C@@H](C/C=C(C)/C=C/[C@H](O)[C@@H](C)CO)O2)O1 |
| InChI | InChI=1S/C26H43O5.3C4H9.Sn/c1-6-8-14-25(24(29)7-2)16-17-26(31-25)15-13-20(4)23(30-26)12-10-19(3)9-11-22(28)21(5)18-27;3*1-3-4-2;/h2,7,9-11,20-24,27-29H,6,8,12-18H2,1,3-5H3;3*1,3-4H2,2H3;/b7-2?,11-9+,19-10+;;;;/t20-,21-,22-,23+,24-,25+,26-;;;;/m0..../s1 |
| InChIKey | NBLPZGQMKBYKGX-SVUNIXGNSA-N |
| XLogP | 9.42 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.68 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|