C48H63NO6 — CID 10865535
methyl 2-(5,11,17,25-tetratert-butyl-27,28,29,30-tetrahydroxy-21-azapentacyclo[21.3.1.13,7.19,13.115,19]triaconta-1(27),3,5,7(30),9(29),10,12,15(28),16,18,23,25-dodecaen-21-yl)acetate (PubChem CID 10865535) has the molecular formula C48H63NO6 and a molecular weight of 750.03 g/mol. Its IUPAC name is methyl 2-(5,11,17,25-tetratert-butyl-27,28,29,30-tetrahydroxy-21-azapentacyclo[21.3.1.13,7.19,13.115,19]triaconta-1(27),3,5,7(30),9(29),10,12,15(28),16,18,23,25-dodecaen-21-yl)acetate.
| Compound Name | methyl 2-(5,11,17,25-tetratert-butyl-27,28,29,30-tetrahydroxy-21-azapentacyclo[21.3.1.13,7.19,13.115,19]triaconta-1(27),3,5,7(30),9(29),10,12,15(28),16,18,23,25-dodecaen-21-yl)acetate |
|---|---|
| PubChem CID | 10865535 |
| Molecular Formula | C48H63NO6 |
| Molecular Weight | 750.03 g/mol |
| Exact Mass | 749.47 |
| IUPAC Name | methyl 2-(5,11,17,25-tetratert-butyl-27,28,29,30-tetrahydroxy-21-azapentacyclo[21.3.1.13,7.19,13.115,19]triaconta-1(27),3,5,7(30),9(29),10,12,15(28),16,18,23,25-dodecaen-21-yl)acetate |
| SMILES | COC(=O)CN1Cc2cc(C(C)(C)C)cc(c2O)Cc2cc(C(C)(C)C)cc(c2O)Cc2cc(C(C)(C)C)cc(c2O)Cc2cc(C(C)(C)C)cc(c2O)C1 |
| InChI | InChI=1S/C48H63NO6/c1-45(2,3)36-17-28-14-29-18-37(46(4,5)6)20-31(42(29)52)16-33-22-39(48(10,11)12)24-35(44(33)54)26-49(27-40(50)55-13)25-34-23-38(47(7,8)9)21-32(43(34)53)15-30(19-36)41(28)51/h17-24,51-54H,14-16,25-27H2,1-13H3 |
| InChIKey | SDLBBTOCUPFTFF-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.03 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|