C39H47IO4SSi — CID 10865593
(Z,4R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3-iodo-5-[(4-methoxyphenyl)methoxy]-6,6-dimethyl-7-phenylsulfanylhept-2-en-4-ol (PubChem CID 10865593) has the molecular formula C39H47IO4SSi and a molecular weight of 766.86 g/mol. Its IUPAC name is (Z,4R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3-iodo-5-[(4-methoxyphenyl)methoxy]-6,6-dimethyl-7-phenylsulfanylhept-2-en-4-ol.
| Compound Name | (Z,4R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3-iodo-5-[(4-methoxyphenyl)methoxy]-6,6-dimethyl-7-phenylsulfanylhept-2-en-4-ol |
|---|---|
| PubChem CID | 10865593 |
| Molecular Formula | C39H47IO4SSi |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.20 |
| IUPAC Name | (Z,4R,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3-iodo-5-[(4-methoxyphenyl)methoxy]-6,6-dimethyl-7-phenylsulfanylhept-2-en-4-ol |
| SMILES | COc1ccc(CO[C@H]([C@@H](O)/C(I)=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)(C)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C39H47IO4SSi/c1-38(2,3)46(33-18-12-8-13-19-33,34-20-14-9-15-21-34)44-27-26-35(40)36(41)37(43-28-30-22-24-31(42-6)25-23-30)39(4,5)29-45-32-16-10-7-11-17-32/h7-26,36-37,41H,27-29H2,1-6H3/b35-26-/t36-,37+/m0/s1 |
| InChIKey | SZONILTUQQPTAE-UPYQDFENSA-N |
| XLogP | 8.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|