C42H66N10O2S4 — CID 10865823
13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazatricyclo[23.3.1.111,15]triacontane-2,10,16,24-tetrathione (PubChem CID 10865823) has the molecular formula C42H66N10O2S4 and a molecular weight of 871.33 g/mol. Its IUPAC name is 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazatricyclo[23.3.1.111,15]triacontane-2,10,16,24-tetrathione.
| Compound Name | 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazatricyclo[23.3.1.111,15]triacontane-2,10,16,24-tetrathione |
|---|---|
| PubChem CID | 10865823 |
| Molecular Formula | C42H66N10O2S4 |
| Molecular Weight | 871.33 g/mol |
| Exact Mass | 870.43 |
| IUPAC Name | 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazatricyclo[23.3.1.111,15]triacontane-2,10,16,24-tetrathione |
| SMILES | S=C1NCCNCCNC(=S)N2CC(CCCCOCc3ccccc3)CN(C2)C(=S)NCCNCCNC(=S)N2CC(CCCCOCc3ccccc3)CN1C2 |
| InChI | InChI=1S/C42H66N10O2S4/c55-39-45-21-17-43-19-23-47-41(57)51-29-38(16-8-10-26-54-32-36-13-5-2-6-14-36)30-52(34-51)42(58)48-24-20-44-18-22-46-40(56)50-28-37(27-49(39)33-50)15-7-9-25-53-31-35-11-3-1-4-12-35/h1-6,11-14,37-38,43-44H,7-10,15-34H2,(H,45,55)(H,46,56)(H,47,57)(H,48,58) |
| InChIKey | AZNRXDXNKFYKKH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|