C17H17NO5 — CID 108659912
1-(furan-2-ylmethyl)-4-hydroxy-2-(5-methylfuran-2-yl)-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108659912) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-hydroxy-2-(5-methylfuran-2-yl)-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(5-methylfuran-2-yl)-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108659912 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(5-methylfuran-2-yl)-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(Cc2ccco2)C1c1ccc(C)o1 |
| InChI | InChI=1S/C17H17NO5/c1-3-12(19)14-15(13-7-6-10(2)23-13)18(17(21)16(14)20)9-11-5-4-8-22-11/h4-8,15,20H,3,9H2,1-2H3 |
| InChIKey | CQYYKAYFMDFTCB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |