About CID 10866121
CID 10866121 (PubChem CID 10866121) has the molecular formula C53H40
and a molecular weight of 676.90 g/mol.
Molecular Properties
| Compound Name | CID 10866121 |
| PubChem CID | 10866121 |
| Molecular Formula | C53H40 |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](/C=C/c2ccc(C(c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)(c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)cc2)[CH]1 |
| InChI | InChI=1S/C53H40/c1-2-10-41(9-1)17-21-45-25-33-49(34-26-45)53(50-35-27-46(28-36-50)22-18-42-11-3-4-12-42,51-37-29-47(30-38-51)23-19-43-13-5-6-14-43)52-39-31-48(32-40-52)24-20-44-15-7-8-16-44/h1-40H/b21-17+,22-18+,23-19+,24-20+ |
| InChIKey | BYYZULUQKQCQLF-OKNOEDMOSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 10866121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10866121?
The IUPAC name of CID 10866121 (CID 10866121) is not available.
What is the SMILES notation for CID 10866121?
The canonical SMILES for CID 10866121 is [CH]1[CH][CH][C](/C=C/c2ccc(C(c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)(c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)c3ccc(/C=C/[C]4[CH][CH][CH][CH]4)cc3)cc2)[CH]1.
What is the InChIKey of CID 10866121?
The InChIKey is BYYZULUQKQCQLF-OKNOEDMOSA-N. The full InChI is InChI=1S/C53H40/c1-2-10-41(9-1)17-21-45-25-33-49(34-26-45)53(50-35-27-46(28-36-50)22-18-42-11-3-4-12-42,51-37-29-47(30-38-51)23-19-43-13-5-6-14-43)52-39-31-48(32-40-52)24-20-44-15-7-8-16-44/h1-40H/b21-17+,22-18+,23-19+,24-20+.
What are the key properties of CID 10866121?
CID 10866121 has a molecular weight of 676.90 g/mol, XLogP of 11.74, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10866121 is sourced from PubChem (CID 10866121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).