C26H22FNO3S — CID 108661628
(4Z)-1-(3-fluorophenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108661628) has the molecular formula C26H22FNO3S and a molecular weight of 447.53 g/mol. Its IUPAC name is (4Z)-1-(3-fluorophenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(3-fluorophenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108661628 |
| Molecular Formula | C26H22FNO3S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (4Z)-1-(3-fluorophenyl)-4-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccsc1C1/C(=C(/O)c2ccc3c(c2)CCCC3)C(=O)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C26H22FNO3S/c1-15-11-12-32-25(15)22-21(23(29)18-10-9-16-5-2-3-6-17(16)13-18)24(30)26(31)28(22)20-8-4-7-19(27)14-20/h4,7-14,22,29H,2-3,5-6H2,1H3/b23-21- |
| InChIKey | KETQELUTRXJVKS-LNVKXUELSA-N |
| XLogP | 5.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|