C27H27NO5S — CID 108661864
(4Z)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108661864) has the molecular formula C27H27NO5S and a molecular weight of 477.58 g/mol. Its IUPAC name is (4Z)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108661864 |
| Molecular Formula | C27H27NO5S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (4Z)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccccc3O)C2c2sccc2C)cc1C(C)C |
| InChI | InChI=1S/C27H27NO5S/c1-5-33-21-11-10-17(14-18(21)15(2)3)24(30)22-23(26-16(4)12-13-34-26)28(27(32)25(22)31)19-8-6-7-9-20(19)29/h6-15,23,29-30H,5H2,1-4H3/b24-22- |
| InChIKey | VJMOUUFCHYEAKI-GYHWCHFESA-N |
| XLogP | 5.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|