C22H17Cl2NO5S — CID 108662311
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108662311) has the molecular formula C22H17Cl2NO5S and a molecular weight of 478.35 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108662311 |
| Molecular Formula | C22H17Cl2NO5S |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(Cc2ccco2)C1c1sccc1C |
| InChI | InChI=1S/C22H17Cl2NO5S/c1-11-5-7-31-21(11)17-16(18(26)14-8-12(23)9-15(24)20(14)29-2)19(27)22(28)25(17)10-13-4-3-6-30-13/h3-9,17,26H,10H2,1-2H3/b18-16+ |
| InChIKey | GMSOELNIWGKOIZ-FBMGVBCBSA-N |
| XLogP | 5.59 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|