About [(3S,4S)-4-aminopyrrolidin-3-yl]methanol
[(3S,4S)-4-aminopyrrolidin-3-yl]methanol (PubChem CID 10866309) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is [(3S,4S)-4-aminopyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4S)-4-aminopyrrolidin-3-yl]methanol |
| PubChem CID | 10866309 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | [(3S,4S)-4-aminopyrrolidin-3-yl]methanol |
| SMILES | N[C@@H]1CNC[C@@H]1CO |
| InChI | InChI=1S/C5H12N2O/c6-5-2-7-1-4(5)3-8/h4-5,7-8H,1-3,6H2/t4-,5-/m1/s1 |
| InChIKey | LLXSCSIQSWFARG-RFZPGFLSSA-N |
| XLogP | -1.47 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4S)-4-aminopyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-aminopyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4S)-4-aminopyrrolidin-3-yl]methanol (CID 10866309) is [(3S,4S)-4-aminopyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4S)-4-aminopyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4S)-4-aminopyrrolidin-3-yl]methanol is N[C@@H]1CNC[C@@H]1CO.
What is the InChIKey of [(3S,4S)-4-aminopyrrolidin-3-yl]methanol?
The InChIKey is LLXSCSIQSWFARG-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H12N2O/c6-5-2-7-1-4(5)3-8/h4-5,7-8H,1-3,6H2/t4-,5-/m1/s1.
What are the key properties of [(3S,4S)-4-aminopyrrolidin-3-yl]methanol?
[(3S,4S)-4-aminopyrrolidin-3-yl]methanol has a molecular weight of 116.16 g/mol, XLogP of -1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-aminopyrrolidin-3-yl]methanol is sourced from PubChem (CID 10866309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).