About 3-(methoxymethyl)pentane
3-(methoxymethyl)pentane (PubChem CID 10866310) has the molecular formula C7H16O
and a molecular weight of 116.20 g/mol. Its IUPAC name is 3-(methoxymethyl)pentane.
Molecular Properties
| Compound Name | 3-(methoxymethyl)pentane |
| PubChem CID | 10866310 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | 3-(methoxymethyl)pentane |
| SMILES | CCC(CC)COC |
| InChI | InChI=1S/C7H16O/c1-4-7(5-2)6-8-3/h7H,4-6H2,1-3H3 |
| InChIKey | JWXGQJXUAIXQEP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(methoxymethyl)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)pentane?
The IUPAC name of 3-(methoxymethyl)pentane (CID 10866310) is 3-(methoxymethyl)pentane.
What is the SMILES notation for 3-(methoxymethyl)pentane?
The canonical SMILES for 3-(methoxymethyl)pentane is CCC(CC)COC.
What is the InChIKey of 3-(methoxymethyl)pentane?
The InChIKey is JWXGQJXUAIXQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O/c1-4-7(5-2)6-8-3/h7H,4-6H2,1-3H3.
What are the key properties of 3-(methoxymethyl)pentane?
3-(methoxymethyl)pentane has a molecular weight of 116.20 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)pentane is sourced from PubChem (CID 10866310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).