C27H35NO4S — CID 108663156
(4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-pentylpyrrolidine-2,3-dione (PubChem CID 108663156) has the molecular formula C27H35NO4S and a molecular weight of 469.65 g/mol. Its IUPAC name is (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-pentylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-pentylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108663156 |
| Molecular Formula | C27H35NO4S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-pentylpyrrolidine-2,3-dione |
| SMILES | CCCCCN1C(=O)C(=O)/C(=C(\O)c2ccc(OCC)c(C(C)(C)C)c2)C1c1sccc1C |
| InChI | InChI=1S/C27H35NO4S/c1-7-9-10-14-28-22(25-17(3)13-15-33-25)21(24(30)26(28)31)23(29)18-11-12-20(32-8-2)19(16-18)27(4,5)6/h11-13,15-16,22,29H,7-10,14H2,1-6H3/b23-21- |
| InChIKey | OCRRSHLGBLVYRH-LNVKXUELSA-N |
| XLogP | 6.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|