About (2S)-1,1-dimethoxypropan-2-amine
(2S)-1,1-dimethoxypropan-2-amine (PubChem CID 10866318) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is (2S)-1,1-dimethoxypropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1,1-dimethoxypropan-2-amine |
| PubChem CID | 10866318 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | (2S)-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)[C@H](C)N |
| InChI | InChI=1S/C5H13NO2/c1-4(6)5(7-2)8-3/h4-5H,6H2,1-3H3/t4-/m0/s1 |
| InChIKey | GZOKAVHTSXSLNB-BYPYZUCNSA-N |
| XLogP | -0.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1-dimethoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1-dimethoxypropan-2-amine?
The IUPAC name of (2S)-1,1-dimethoxypropan-2-amine (CID 10866318) is (2S)-1,1-dimethoxypropan-2-amine.
What is the SMILES notation for (2S)-1,1-dimethoxypropan-2-amine?
The canonical SMILES for (2S)-1,1-dimethoxypropan-2-amine is COC(OC)[C@H](C)N.
What is the InChIKey of (2S)-1,1-dimethoxypropan-2-amine?
The InChIKey is GZOKAVHTSXSLNB-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H13NO2/c1-4(6)5(7-2)8-3/h4-5H,6H2,1-3H3/t4-/m0/s1.
What are the key properties of (2S)-1,1-dimethoxypropan-2-amine?
(2S)-1,1-dimethoxypropan-2-amine has a molecular weight of 119.16 g/mol, XLogP of -0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-dimethoxypropan-2-amine is sourced from PubChem (CID 10866318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).