C22H22N2O5 — CID 108663455
[4-[(3Z)-1-butyl-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663455) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [4-[(3Z)-1-butyl-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-1-butyl-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663455 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [4-[(3Z)-1-butyl-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(\O)c2ccncc2)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-3-4-13-24-19(15-5-7-17(8-6-15)29-14(2)25)18(21(27)22(24)28)20(26)16-9-11-23-12-10-16/h5-12,19,26H,3-4,13H2,1-2H3/b20-18- |
| InChIKey | KYXQXIWSDYIUIZ-ZZEZOPTASA-N |
| XLogP | 3.23 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|