About 3-ethoxy-2H-furan-5-one
3-ethoxy-2H-furan-5-one (PubChem CID 10866347) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-ethoxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-ethoxy-2H-furan-5-one |
| PubChem CID | 10866347 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3-ethoxy-2H-furan-5-one |
| SMILES | CCOC1=CC(=O)OC1 |
| InChI | InChI=1S/C6H8O3/c1-2-8-5-3-6(7)9-4-5/h3H,2,4H2,1H3 |
| InChIKey | WRXKKVYMUWQSDZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2H-furan-5-one?
The IUPAC name of 3-ethoxy-2H-furan-5-one (CID 10866347) is 3-ethoxy-2H-furan-5-one.
What is the SMILES notation for 3-ethoxy-2H-furan-5-one?
The canonical SMILES for 3-ethoxy-2H-furan-5-one is CCOC1=CC(=O)OC1.
What is the InChIKey of 3-ethoxy-2H-furan-5-one?
The InChIKey is WRXKKVYMUWQSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-2-8-5-3-6(7)9-4-5/h3H,2,4H2,1H3.
What are the key properties of 3-ethoxy-2H-furan-5-one?
3-ethoxy-2H-furan-5-one has a molecular weight of 128.13 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2H-furan-5-one is sourced from PubChem (CID 10866347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).