C22H20N2O7 — CID 108663540
[4-[(3Z)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663540) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is [4-[(3Z)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663540 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [4-[(3Z)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2ccc([N+](=O)[O-])cc2)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C22H20N2O7/c1-3-12-23-19(14-6-10-17(11-7-14)31-13(2)25)18(21(27)22(23)28)20(26)15-4-8-16(9-5-15)24(29)30/h4-11,19,26H,3,12H2,1-2H3/b20-18- |
| InChIKey | HXPIQVAVIYZINV-ZZEZOPTASA-N |
| XLogP | 3.35 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|