About [(2R)-oxiran-2-yl]methyl propanoate
[(2R)-oxiran-2-yl]methyl propanoate (PubChem CID 10866361) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl propanoate.
Molecular Properties
| Compound Name | [(2R)-oxiran-2-yl]methyl propanoate |
| PubChem CID | 10866361 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1CO1 |
| InChI | InChI=1S/C6H10O3/c1-2-6(7)9-4-5-3-8-5/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | QNAJAJLBHMMOJB-RXMQYKEDSA-N |
| XLogP | 0.34 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxiran-2-yl]methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxiran-2-yl]methyl propanoate?
The IUPAC name of [(2R)-oxiran-2-yl]methyl propanoate (CID 10866361) is [(2R)-oxiran-2-yl]methyl propanoate.
What is the SMILES notation for [(2R)-oxiran-2-yl]methyl propanoate?
The canonical SMILES for [(2R)-oxiran-2-yl]methyl propanoate is CCC(=O)OC[C@H]1CO1.
What is the InChIKey of [(2R)-oxiran-2-yl]methyl propanoate?
The InChIKey is QNAJAJLBHMMOJB-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O3/c1-2-6(7)9-4-5-3-8-5/h5H,2-4H2,1H3/t5-/m1/s1.
What are the key properties of [(2R)-oxiran-2-yl]methyl propanoate?
[(2R)-oxiran-2-yl]methyl propanoate has a molecular weight of 130.14 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxiran-2-yl]methyl propanoate is sourced from PubChem (CID 10866361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).