C28H33NO6 — CID 108663687
[3-[(3E)-1-butyl-3-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663687) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is [3-[(3E)-1-butyl-3-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3E)-1-butyl-3-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663687 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | [3-[(3E)-1-butyl-3-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(/O)c2ccc(OC)c(C(C)(C)C)c2)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C28H33NO6/c1-7-8-14-29-24(18-10-9-11-20(15-18)35-17(2)30)23(26(32)27(29)33)25(31)19-12-13-22(34-6)21(16-19)28(3,4)5/h9-13,15-16,24,31H,7-8,14H2,1-6H3/b25-23+ |
| InChIKey | QLQLDAJUJWUGIZ-WJTDDFOZSA-N |
| XLogP | 5.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|