About lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one
lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one (PubChem CID 10866381) has the molecular formula C6H10LiNO2
and a molecular weight of 135.09 g/mol. Its IUPAC name is lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one.
Molecular Properties
| Compound Name | lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one |
| PubChem CID | 10866381 |
| Molecular Formula | C6H10LiNO2 |
| Molecular Weight | 135.09 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one |
| SMILES | CC(C)[C@@H]1COC(=O)[N-]1.[Li+] |
| InChI | InChI=1S/C6H11NO2.Li/c1-4(2)5-3-9-6(8)7-5;/h4-5H,3H2,1-2H3,(H,7,8);/q;+1/p-1/t5-;/m0./s1 |
| InChIKey | UMVXXAHAUGRFCT-JEDNCBNOSA-M |
| XLogP | -1.46 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.09 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one?
The IUPAC name of lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one (CID 10866381) is lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one.
What is the SMILES notation for lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one?
The canonical SMILES for lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one is CC(C)[C@@H]1COC(=O)[N-]1.[Li+].
What is the InChIKey of lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one?
The InChIKey is UMVXXAHAUGRFCT-JEDNCBNOSA-M. The full InChI is InChI=1S/C6H11NO2.Li/c1-4(2)5-3-9-6(8)7-5;/h4-5H,3H2,1-2H3,(H,7,8);/q;+1/p-1/t5-;/m0./s1.
What are the key properties of lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one?
lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one has a molecular weight of 135.09 g/mol, XLogP of -1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (4R)-4-propan-2-yl-1,3-oxazolidin-3-id-2-one is sourced from PubChem (CID 10866381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).